C17H22N4O4 — CID 108874898
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-morpholin-4-ylethyl)urea (PubChem CID 108874898) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-morpholin-4-ylethyl)urea.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 108874898 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-3-(2-morpholin-4-ylethyl)urea |
| SMILES | O=C(NCCN1CCOCC1)NCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22N4O4/c22-15-13-3-1-2-4-14(13)16(23)21(15)8-6-19-17(24)18-5-7-20-9-11-25-12-10-20/h1-4H,5-12H2,(H2,18,19,24) |
| InChIKey | MIYRJPJOUPBFPQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|