C16H19N3O4 — CID 4629546
2-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 4629546) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 4629546 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C16H19N3O4/c20-14(17-5-6-18-7-9-23-10-8-18)11-19-15(21)12-3-1-2-4-13(12)16(19)22/h1-4H,5-11H2,(H,17,20) |
| InChIKey | NGKIVUBSQNJYFT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|