C22H22N4O5 — CID 16612015
N-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]-2-morpholin-4-ylacetamide (PubChem CID 16612015) has the molecular formula C22H22N4O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is N-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 16612015 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | N-[4-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]phenyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(NC(=O)CN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C22H22N4O5/c27-19(13-25-9-11-31-12-10-25)23-15-5-7-16(8-6-15)24-20(28)14-26-21(29)17-3-1-2-4-18(17)22(26)30/h1-8H,9-14H2,(H,23,27)(H,24,28) |
| InChIKey | VNNVHYAKNGRKLY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|