C15H24Cl2N4O3 — CID 119840811
3-amino-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride (PubChem CID 119840811) has the molecular formula C15H24Cl2N4O3 and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-amino-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119840811 |
| Molecular Formula | C15H24Cl2N4O3 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-amino-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCC(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C15H22N4O3.2ClH/c16-6-5-14(20)17-12-1-3-13(4-2-12)18-15(21)11-19-7-9-22-10-8-19;;/h1-4H,5-11,16H2,(H,17,20)(H,18,21);2*1H |
| InChIKey | OPHWKLXTOCSXNZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |