C21H28Cl2N4O3 — CID 120612232
3-(2-aminophenyl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride (PubChem CID 120612232) has the molecular formula C21H28Cl2N4O3 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612232 |
| Molecular Formula | C21H28Cl2N4O3 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-(2-aminophenyl)-N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccccc1CCC(=O)Nc1ccc(NC(=O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C21H26N4O3.2ClH/c22-19-4-2-1-3-16(19)5-10-20(26)23-17-6-8-18(9-7-17)24-21(27)15-25-11-13-28-14-12-25;;/h1-4,6-9H,5,10-15,22H2,(H,23,26)(H,24,27);2*1H |
| InChIKey | NXEWVTKCXMZATG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|