C26H27N3O3 — CID 16612010
N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-2,2-diphenylacetamide (PubChem CID 16612010) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-2,2-diphenylacetamide.
| Compound Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 16612010 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | N-[4-[(2-morpholin-4-ylacetyl)amino]phenyl]-2,2-diphenylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1ccc(NC(=O)C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c30-24(19-29-15-17-32-18-16-29)27-22-11-13-23(14-12-22)28-26(31)25(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-14,25H,15-19H2,(H,27,30)(H,28,31) |
| InChIKey | HDJHKRYZJJIKMB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |