C18H30Cl2N4O2 — CID 119908408
2-(4-aminopiperidin-1-yl)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride (PubChem CID 119908408) has the molecular formula C18H30Cl2N4O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119908408 |
| Molecular Formula | C18H30Cl2N4O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-[4-(morpholin-4-ylmethyl)phenyl]acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CC(=O)Nc2ccc(CN3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O2.2ClH/c19-16-5-7-21(8-6-16)14-18(23)20-17-3-1-15(2-4-17)13-22-9-11-24-12-10-22;;/h1-4,16H,5-14,19H2,(H,20,23);2*1H |
| InChIKey | BMXGECRKEZMXAW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |