C17H24N4O3 — CID 26623969
N-[4-(morpholin-4-ylmethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 26623969) has the molecular formula C17H24N4O3 and a molecular weight of 332.40 g/mol. Its IUPAC name is N-[4-(morpholin-4-ylmethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 26623969 |
| Molecular Formula | C17H24N4O3 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | N-[4-(morpholin-4-ylmethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | O=C1CN(CC(=O)Nc2ccc(CN3CCOCC3)cc2)CCN1 |
| InChI | InChI=1S/C17H24N4O3/c22-16-12-21(6-5-18-16)13-17(23)19-15-3-1-14(2-4-15)11-20-7-9-24-10-8-20/h1-4H,5-13H2,(H,18,22)(H,19,23) |
| InChIKey | JUERRXZMJYQEAT-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |