C12H13Cl2N3O2 — CID 2113839
N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 2113839) has the molecular formula C12H13Cl2N3O2 and a molecular weight of 302.16 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 2113839 |
| Molecular Formula | C12H13Cl2N3O2 |
| Molecular Weight | 302.16 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | O=C1CN(CC(=O)Nc2cc(Cl)cc(Cl)c2)CCN1 |
| InChI | InChI=1S/C12H13Cl2N3O2/c13-8-3-9(14)5-10(4-8)16-12(19)7-17-2-1-15-11(18)6-17/h3-5H,1-2,6-7H2,(H,15,18)(H,16,19) |
| InChIKey | KFWQFBMRDFWLEM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |