C12H14Cl2N2O2 — CID 717337
N-(3,5-dichlorophenyl)-2-morpholin-4-ylacetamide (PubChem CID 717337) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-morpholin-4-ylacetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 717337 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c13-9-5-10(14)7-11(6-9)15-12(17)8-16-1-3-18-4-2-16/h5-7H,1-4,8H2,(H,15,17) |
| InChIKey | NKEOLRWGTITEKX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |