C15H20ClN3O3 — CID 139237672
5-chloro-N,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]benzamide (PubChem CID 139237672) has the molecular formula C15H20ClN3O3 and a molecular weight of 325.80 g/mol. Its IUPAC name is 5-chloro-N,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]benzamide.
| Compound Name | 5-chloro-N,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 139237672 |
| Molecular Formula | C15H20ClN3O3 |
| Molecular Weight | 325.80 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 5-chloro-N,3-dimethyl-2-[(2-morpholin-4-ylacetyl)amino]benzamide |
| SMILES | CNC(=O)c1cc(Cl)cc(C)c1NC(=O)CN1CCOCC1 |
| InChI | InChI=1S/C15H20ClN3O3/c1-10-7-11(16)8-12(15(21)17-2)14(10)18-13(20)9-19-3-5-22-6-4-19/h7-8H,3-6,9H2,1-2H3,(H,17,21)(H,18,20) |
| InChIKey | OTUICEPDEVTCKB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.80 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |