C34H52N4O6 — CID 3090863
2-[16-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 3090863) has the molecular formula C34H52N4O6 and a molecular weight of 612.81 g/mol. Its IUPAC name is 2-[16-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[16-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 3090863 |
| Molecular Formula | C34H52N4O6 |
| Molecular Weight | 612.81 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | 2-[16-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]-1,4,10,13-tetraoxa-7,16-diazacyclooctadec-7-yl]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN2CCOCCOCCN(CC(=O)Nc3c(C)cc(C)cc3C)CCOCCOCC2)c(C)c1 |
| InChI | InChI=1S/C34H52N4O6/c1-25-19-27(3)33(28(4)20-25)35-31(39)23-37-7-11-41-15-17-43-13-9-38(10-14-44-18-16-42-12-8-37)24-32(40)36-34-29(5)21-26(2)22-30(34)6/h19-22H,7-18,23-24H2,1-6H3,(H,35,39)(H,36,40) |
| InChIKey | YNKHNWBXNBUSLM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.81 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |