C16H14Cl2N2O — CID 126213434
N-(3,5-dichlorophenyl)-2-(1,3-dihydroisoindol-2-yl)acetamide (PubChem CID 126213434) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(1,3-dihydroisoindol-2-yl)acetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(1,3-dihydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 126213434 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(1,3-dihydroisoindol-2-yl)acetamide |
| SMILES | O=C(CN1Cc2ccccc2C1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2O/c17-13-5-14(18)7-15(6-13)19-16(21)10-20-8-11-3-1-2-4-12(11)9-20/h1-7H,8-10H2,(H,19,21) |
| InChIKey | UAGUOORHSQUEKU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |