C19H19Cl2N3O2 — CID 31149355
2-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-N-phenylacetamide (PubChem CID 31149355) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 31149355 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[4-(3,5-dichlorobenzoyl)piperazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(CN1CCN(C(=O)c2cc(Cl)cc(Cl)c2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c20-15-10-14(11-16(21)12-15)19(26)24-8-6-23(7-9-24)13-18(25)22-17-4-2-1-3-5-17/h1-5,10-12H,6-9,13H2,(H,22,25) |
| InChIKey | YLBQCSVCDMOXGU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |