C26H25ClN4O3 — CID 46551898
2-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]acetyl]amino]-N-phenylbenzamide (PubChem CID 46551898) has the molecular formula C26H25ClN4O3 and a molecular weight of 476.96 g/mol. Its IUPAC name is 2-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]acetyl]amino]-N-phenylbenzamide.
| Compound Name | 2-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]acetyl]amino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 46551898 |
| Molecular Formula | C26H25ClN4O3 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-[[2-[4-(4-chlorobenzoyl)piperazin-1-yl]acetyl]amino]-N-phenylbenzamide |
| SMILES | O=C(CN1CCN(C(=O)c2ccc(Cl)cc2)CC1)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H25ClN4O3/c27-20-12-10-19(11-13-20)26(34)31-16-14-30(15-17-31)18-24(32)29-23-9-5-4-8-22(23)25(33)28-21-6-2-1-3-7-21/h1-13H,14-18H2,(H,28,33)(H,29,32) |
| InChIKey | QJTPTZBLCANZJO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |