C13H15F3N4O2 — CID 16778689
N-[4-amino-3-(trifluoromethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 16778689) has the molecular formula C13H15F3N4O2 and a molecular weight of 316.28 g/mol. Its IUPAC name is N-[4-amino-3-(trifluoromethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 16778689 |
| Molecular Formula | C13H15F3N4O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | Nc1ccc(NC(=O)CN2CCNC(=O)C2)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N4O2/c14-13(15,16)9-5-8(1-2-10(9)17)19-12(22)7-20-4-3-18-11(21)6-20/h1-2,5H,3-4,6-7,17H2,(H,18,21)(H,19,22) |
| InChIKey | HIFXIHYSSYZANY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|