C12H14Cl2N4O2 — CID 29276726
N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 29276726) has the molecular formula C12H14Cl2N4O2 and a molecular weight of 317.18 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 29276726 |
| Molecular Formula | C12H14Cl2N4O2 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)CN1CCNC(=O)C1 |
| InChI | InChI=1S/C12H14Cl2N4O2/c13-7-3-8(14)12(9(15)4-7)17-11(20)6-18-2-1-16-10(19)5-18/h3-4H,1-2,5-6,15H2,(H,16,19)(H,17,20) |
| InChIKey | YPIDUOFJHXUTLA-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|