C13H16Cl2N4O2 — CID 43078334
N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide (PubChem CID 43078334) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide |
|---|---|
| PubChem CID | 43078334 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-oxopiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)Nc1c(N)cc(Cl)cc1Cl)N1CCNC(=O)C1 |
| InChI | InChI=1S/C13H16Cl2N4O2/c1-7(19-3-2-17-11(20)6-19)13(21)18-12-9(15)4-8(14)5-10(12)16/h4-5,7H,2-3,6,16H2,1H3,(H,17,20)(H,18,21) |
| InChIKey | PSBZIZQUTZDSGP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|