C15H23Cl2N3O — CID 43274116
N-(2-amino-4,6-dichlorophenyl)-2-[butan-2-yl(ethyl)amino]propanamide (PubChem CID 43274116) has the molecular formula C15H23Cl2N3O and a molecular weight of 332.28 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-[butan-2-yl(ethyl)amino]propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-[butan-2-yl(ethyl)amino]propanamide |
|---|---|
| PubChem CID | 43274116 |
| Molecular Formula | C15H23Cl2N3O |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-[butan-2-yl(ethyl)amino]propanamide |
| SMILES | CCC(C)N(CC)C(C)C(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H23Cl2N3O/c1-5-9(3)20(6-2)10(4)15(21)19-14-12(17)7-11(16)8-13(14)18/h7-10H,5-6,18H2,1-4H3,(H,19,21) |
| InChIKey | FIYXGVGASRFNAK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|