C10H13Cl2N3O — CID 16789822
N-(2-amino-4,6-dichlorophenyl)-2-(dimethylamino)acetamide (PubChem CID 16789822) has the molecular formula C10H13Cl2N3O and a molecular weight of 262.14 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(dimethylamino)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 16789822 |
| Molecular Formula | C10H13Cl2N3O |
| Molecular Weight | 262.14 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H13Cl2N3O/c1-15(2)5-9(16)14-10-7(12)3-6(11)4-8(10)13/h3-4H,5,13H2,1-2H3,(H,14,16) |
| InChIKey | XXZPBRHYWOLZIA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.14 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|