C14H21Cl2N3O2 — CID 79380076
N-(2-amino-4,6-dichlorophenyl)-3-[(2-hydroxy-2-methylpropyl)-methylamino]propanamide (PubChem CID 79380076) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-3-[(2-hydroxy-2-methylpropyl)-methylamino]propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-3-[(2-hydroxy-2-methylpropyl)-methylamino]propanamide |
|---|---|
| PubChem CID | 79380076 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-3-[(2-hydroxy-2-methylpropyl)-methylamino]propanamide |
| SMILES | CN(CCC(=O)Nc1c(N)cc(Cl)cc1Cl)CC(C)(C)O |
| InChI | InChI=1S/C14H21Cl2N3O2/c1-14(2,21)8-19(3)5-4-12(20)18-13-10(16)6-9(15)7-11(13)17/h6-7,21H,4-5,8,17H2,1-3H3,(H,18,20) |
| InChIKey | GTTKWARSLXYHKE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|