C14H21Cl2N3O2 — CID 61428718
N-(2-amino-4,6-dichlorophenyl)-4-[2-methoxyethyl(methyl)amino]butanamide (PubChem CID 61428718) has the molecular formula C14H21Cl2N3O2 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-4-[2-methoxyethyl(methyl)amino]butanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-4-[2-methoxyethyl(methyl)amino]butanamide |
|---|---|
| PubChem CID | 61428718 |
| Molecular Formula | C14H21Cl2N3O2 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-4-[2-methoxyethyl(methyl)amino]butanamide |
| SMILES | COCCN(C)CCCC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H21Cl2N3O2/c1-19(6-7-21-2)5-3-4-13(20)18-14-11(16)8-10(15)9-12(14)17/h8-9H,3-7,17H2,1-2H3,(H,18,20) |
| InChIKey | KUSMZNVAXZMGMM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|