C12H16Cl2N2O2S — CID 61304232
N-(2-amino-4,6-dichlorophenyl)-2-tert-butylsulfinylacetamide (PubChem CID 61304232) has the molecular formula C12H16Cl2N2O2S and a molecular weight of 323.25 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-tert-butylsulfinylacetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-tert-butylsulfinylacetamide |
|---|---|
| PubChem CID | 61304232 |
| Molecular Formula | C12H16Cl2N2O2S |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-tert-butylsulfinylacetamide |
| SMILES | CC(C)(C)S(=O)CC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O2S/c1-12(2,3)19(18)6-10(17)16-11-8(14)4-7(13)5-9(11)15/h4-5H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | CUWJADRFVLVOOS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|