C14H20Cl2N2O3 — CID 115941858
N-(2-amino-4,6-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]acetamide (PubChem CID 115941858) has the molecular formula C14H20Cl2N2O3 and a molecular weight of 335.23 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 115941858 |
| Molecular Formula | C14H20Cl2N2O3 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]ethoxy]acetamide |
| SMILES | CC(C)(C)OCCOCC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C14H20Cl2N2O3/c1-14(2,3)21-5-4-20-8-12(19)18-13-10(16)6-9(15)7-11(13)17/h6-7H,4-5,8,17H2,1-3H3,(H,18,19) |
| InChIKey | CKMQUAFZAQTVBP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|