C12H16Cl2N4O2 — CID 103101399
2-[[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]-ethylamino]acetamide (PubChem CID 103101399) has the molecular formula C12H16Cl2N4O2 and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-[[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]-ethylamino]acetamide.
| Compound Name | 2-[[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]-ethylamino]acetamide |
|---|---|
| PubChem CID | 103101399 |
| Molecular Formula | C12H16Cl2N4O2 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-[[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)CC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N4O2/c1-2-18(5-10(16)19)6-11(20)17-12-8(14)3-7(13)4-9(12)15/h3-4H,2,5-6,15H2,1H3,(H2,16,19)(H,17,20) |
| InChIKey | OPAODMJEOCWFSO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|