C15H21Cl2N3O — CID 43540670
N-(2-amino-4,6-dichlorophenyl)-2-[cyclopentyl(ethyl)amino]acetamide (PubChem CID 43540670) has the molecular formula C15H21Cl2N3O and a molecular weight of 330.26 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-[cyclopentyl(ethyl)amino]acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-[cyclopentyl(ethyl)amino]acetamide |
|---|---|
| PubChem CID | 43540670 |
| Molecular Formula | C15H21Cl2N3O |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-[cyclopentyl(ethyl)amino]acetamide |
| SMILES | CCN(CC(=O)Nc1c(N)cc(Cl)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C15H21Cl2N3O/c1-2-20(11-5-3-4-6-11)9-14(21)19-15-12(17)7-10(16)8-13(15)18/h7-8,11H,2-6,9,18H2,1H3,(H,19,21) |
| InChIKey | HWZFGRJMTJFFCH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|