C16H22Cl3N3O — CID 119932936
2-[piperidin-4-yl(propyl)amino]-N-(2,4,6-trichlorophenyl)acetamide (PubChem CID 119932936) has the molecular formula C16H22Cl3N3O and a molecular weight of 378.73 g/mol. Its IUPAC name is 2-[piperidin-4-yl(propyl)amino]-N-(2,4,6-trichlorophenyl)acetamide.
| Compound Name | 2-[piperidin-4-yl(propyl)amino]-N-(2,4,6-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 119932936 |
| Molecular Formula | C16H22Cl3N3O |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 2-[piperidin-4-yl(propyl)amino]-N-(2,4,6-trichlorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1c(Cl)cc(Cl)cc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C16H22Cl3N3O/c1-2-7-22(12-3-5-20-6-4-12)10-15(23)21-16-13(18)8-11(17)9-14(16)19/h8-9,12,20H,2-7,10H2,1H3,(H,21,23) |
| InChIKey | BTXLJPPUSCJTDF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |