C18H29N3O — CID 119933101
N-(3,4-dimethylphenyl)-2-[piperidin-4-yl(propyl)amino]acetamide (PubChem CID 119933101) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[piperidin-4-yl(propyl)amino]acetamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[piperidin-4-yl(propyl)amino]acetamide |
|---|---|
| PubChem CID | 119933101 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[piperidin-4-yl(propyl)amino]acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(C)c(C)c1)C1CCNCC1 |
| InChI | InChI=1S/C18H29N3O/c1-4-11-21(17-7-9-19-10-8-17)13-18(22)20-16-6-5-14(2)15(3)12-16/h5-6,12,17,19H,4,7-11,13H2,1-3H3,(H,20,22) |
| InChIKey | NHBHWQHMUZXDSO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |