C17H25Cl2N3O — CID 119932799
N-(2,6-dichlorophenyl)-3-[piperidin-4-yl(propyl)amino]propanamide (PubChem CID 119932799) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-[piperidin-4-yl(propyl)amino]propanamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-[piperidin-4-yl(propyl)amino]propanamide |
|---|---|
| PubChem CID | 119932799 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-[piperidin-4-yl(propyl)amino]propanamide |
| SMILES | CCCN(CCC(=O)Nc1c(Cl)cccc1Cl)C1CCNCC1 |
| InChI | InChI=1S/C17H25Cl2N3O/c1-2-11-22(13-6-9-20-10-7-13)12-8-16(23)21-17-14(18)4-3-5-15(17)19/h3-5,13,20H,2,6-12H2,1H3,(H,21,23) |
| InChIKey | QFULYPMTGHYALE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |