About N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride
N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride (PubChem CID 119929877) has the molecular formula C16H24Cl3N3O
and a molecular weight of 380.75 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride |
| PubChem CID | 119929877 |
| Molecular Formula | C16H24Cl3N3O |
| Molecular Weight | 380.75 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride |
| SMILES | CCN(CC(=O)Nc1c(Cl)cccc1Cl)CC1CCNCC1.Cl |
| InChI | InChI=1S/C16H23Cl2N3O.ClH/c1-2-21(10-12-6-8-19-9-7-12)11-15(22)20-16-13(17)4-3-5-14(16)18;/h3-5,12,19H,2,6-11H2,1H3,(H,20,22);1H |
| InChIKey | CRCZIHKSVCTKQN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.75 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride?
The IUPAC name of N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride (CID 119929877) is N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride.
What is the SMILES notation for N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride?
The canonical SMILES for N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride is CCN(CC(=O)Nc1c(Cl)cccc1Cl)CC1CCNCC1.Cl.
What is the InChIKey of N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride?
The InChIKey is CRCZIHKSVCTKQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23Cl2N3O.ClH/c1-2-21(10-12-6-8-19-9-7-12)11-15(22)20-16-13(17)4-3-5-14(16)18;/h3-5,12,19H,2,6-11H2,1H3,(H,20,22);1H.
What are the key properties of N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride?
N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride has a molecular weight of 380.75 g/mol, XLogP of 3.68, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dichlorophenyl)-2-[ethyl(piperidin-4-ylmethyl)amino]acetamide;hydrochloride is sourced from PubChem (CID 119929877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).