C14H18Cl2N2O — CID 65468978
N-(2,6-dichlorophenyl)-3-piperidin-4-ylpropanamide (PubChem CID 65468978) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-3-piperidin-4-ylpropanamide.
| Compound Name | N-(2,6-dichlorophenyl)-3-piperidin-4-ylpropanamide |
|---|---|
| PubChem CID | 65468978 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N-(2,6-dichlorophenyl)-3-piperidin-4-ylpropanamide |
| SMILES | O=C(CCC1CCNCC1)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O/c15-11-2-1-3-12(16)14(11)18-13(19)5-4-10-6-8-17-9-7-10/h1-3,10,17H,4-9H2,(H,18,19) |
| InChIKey | QEFFCGBSHDQNDT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |