C14H17Cl3N2O — CID 86946248
2-[cyclopropylmethyl(ethyl)amino]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 86946248) has the molecular formula C14H17Cl3N2O and a molecular weight of 335.66 g/mol. Its IUPAC name is 2-[cyclopropylmethyl(ethyl)amino]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[cyclopropylmethyl(ethyl)amino]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 86946248 |
| Molecular Formula | C14H17Cl3N2O |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 2-[cyclopropylmethyl(ethyl)amino]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)CC1CC1 |
| InChI | InChI=1S/C14H17Cl3N2O/c1-2-19(7-9-3-4-9)8-14(20)18-13-6-11(16)10(15)5-12(13)17/h5-6,9H,2-4,7-8H2,1H3,(H,18,20) |
| InChIKey | ODXFYIZXXRIVPQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|