C11H12Cl2N2O3S — CID 43617977
methyl 2-[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 43617977) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is methyl 2-[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | methyl 2-[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 43617977 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | methyl 2-[2-(2-amino-4,6-dichloroanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | COC(=O)CSCC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2N2O3S/c1-18-10(17)5-19-4-9(16)15-11-7(13)2-6(12)3-8(11)14/h2-3H,4-5,14H2,1H3,(H,15,16) |
| InChIKey | WBFWRCPXNIKSIO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|