C13H18Cl2N2OS — CID 107749089
N-(2-amino-4,6-dichlorophenyl)-2-(3-methylbutylsulfanyl)acetamide (PubChem CID 107749089) has the molecular formula C13H18Cl2N2OS and a molecular weight of 321.27 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(3-methylbutylsulfanyl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-methylbutylsulfanyl)acetamide |
|---|---|
| PubChem CID | 107749089 |
| Molecular Formula | C13H18Cl2N2OS |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(3-methylbutylsulfanyl)acetamide |
| SMILES | CC(C)CCSCC(=O)Nc1c(N)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H18Cl2N2OS/c1-8(2)3-4-19-7-12(18)17-13-10(15)5-9(14)6-11(13)16/h5-6,8H,3-4,7,16H2,1-2H3,(H,17,18) |
| InChIKey | YOQNHYHNAZHMBP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|