C14H16Cl2N4O — CID 61225560
N-(2-amino-4,6-dichlorophenyl)-2-(3,4,5-trimethylpyrazol-1-yl)acetamide (PubChem CID 61225560) has the molecular formula C14H16Cl2N4O and a molecular weight of 327.22 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(3,4,5-trimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(3,4,5-trimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 61225560 |
| Molecular Formula | C14H16Cl2N4O |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(3,4,5-trimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2c(N)cc(Cl)cc2Cl)c(C)c1C |
| InChI | InChI=1S/C14H16Cl2N4O/c1-7-8(2)19-20(9(7)3)6-13(21)18-14-11(16)4-10(15)5-12(14)17/h4-5H,6,17H2,1-3H3,(H,18,21) |
| InChIKey | HZIHUGPGWOXFST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|