C13H17Cl2N3O2 — CID 29031982
N-(2-amino-4,6-dichlorophenyl)-2-(4-hydroxypiperidin-1-yl)acetamide (PubChem CID 29031982) has the molecular formula C13H17Cl2N3O2 and a molecular weight of 318.20 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-(4-hydroxypiperidin-1-yl)acetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-(4-hydroxypiperidin-1-yl)acetamide |
|---|---|
| PubChem CID | 29031982 |
| Molecular Formula | C13H17Cl2N3O2 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-(4-hydroxypiperidin-1-yl)acetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C13H17Cl2N3O2/c14-8-5-10(15)13(11(16)6-8)17-12(20)7-18-3-1-9(19)2-4-18/h5-6,9,19H,1-4,7,16H2,(H,17,20) |
| InChIKey | KEVIXZFDNBBLAG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|