C12H15Cl2N3O2 — CID 55131355
N-(4-amino-2,6-dichlorophenyl)-2-(3-hydroxypyrrolidin-1-yl)acetamide (PubChem CID 55131355) has the molecular formula C12H15Cl2N3O2 and a molecular weight of 304.18 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(3-hydroxypyrrolidin-1-yl)acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(3-hydroxypyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 55131355 |
| Molecular Formula | C12H15Cl2N3O2 |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(3-hydroxypyrrolidin-1-yl)acetamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CN2CCC(O)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O2/c13-9-3-7(15)4-10(14)12(9)16-11(19)6-17-2-1-8(18)5-17/h3-4,8,18H,1-2,5-6,15H2,(H,16,19) |
| InChIKey | OAZLQRBDTLRBQB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|