C12H15Cl2N3O3 — CID 106668030
N-(4-amino-2,6-dichlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide (PubChem CID 106668030) has the molecular formula C12H15Cl2N3O3 and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 106668030 |
| Molecular Formula | C12H15Cl2N3O3 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-(3,4-dihydroxypyrrolidin-1-yl)acetamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CN2CC(O)C(O)C2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2N3O3/c13-7-1-6(15)2-8(14)12(7)16-11(20)5-17-3-9(18)10(19)4-17/h1-2,9-10,18-19H,3-5,15H2,(H,16,20) |
| InChIKey | IDSRSMWZXRCJNY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|