C14H18Cl2N2OS — CID 60884915
N-(4-amino-2,6-dichlorophenyl)-2-cyclohexylsulfanylacetamide (PubChem CID 60884915) has the molecular formula C14H18Cl2N2OS and a molecular weight of 333.28 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-cyclohexylsulfanylacetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-cyclohexylsulfanylacetamide |
|---|---|
| PubChem CID | 60884915 |
| Molecular Formula | C14H18Cl2N2OS |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-cyclohexylsulfanylacetamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CSC2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H18Cl2N2OS/c15-11-6-9(17)7-12(16)14(11)18-13(19)8-20-10-4-2-1-3-5-10/h6-7,10H,1-5,8,17H2,(H,18,19) |
| InChIKey | HXPXISAXZMHPBI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|