C13H15BrCl2N2OS — CID 114626544
N-(4-bromo-2,6-dichlorophenyl)-2-piperidin-4-ylsulfanylacetamide (PubChem CID 114626544) has the molecular formula C13H15BrCl2N2OS and a molecular weight of 398.15 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-2-piperidin-4-ylsulfanylacetamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-2-piperidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 114626544 |
| Molecular Formula | C13H15BrCl2N2OS |
| Molecular Weight | 398.15 g/mol |
| Exact Mass | 395.95 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-2-piperidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSC1CCNCC1)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H15BrCl2N2OS/c14-8-5-10(15)13(11(16)6-8)18-12(19)7-20-9-1-3-17-4-2-9/h5-6,9,17H,1-4,7H2,(H,18,19) |
| InChIKey | CMDHTXQNNCZOQT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |