C13H14BrCl2NO — CID 68711978
N-(4-bromo-2,6-dichlorophenyl)-2-cyclopentylacetamide (PubChem CID 68711978) has the molecular formula C13H14BrCl2NO and a molecular weight of 351.07 g/mol. Its IUPAC name is N-(4-bromo-2,6-dichlorophenyl)-2-cyclopentylacetamide.
| Compound Name | N-(4-bromo-2,6-dichlorophenyl)-2-cyclopentylacetamide |
|---|---|
| PubChem CID | 68711978 |
| Molecular Formula | C13H14BrCl2NO |
| Molecular Weight | 351.07 g/mol |
| Exact Mass | 348.96 |
| IUPAC Name | N-(4-bromo-2,6-dichlorophenyl)-2-cyclopentylacetamide |
| SMILES | O=C(CC1CCCC1)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C13H14BrCl2NO/c14-9-6-10(15)13(11(16)7-9)17-12(18)5-8-3-1-2-4-8/h6-8H,1-5H2,(H,17,18) |
| InChIKey | CUZIFDPKVXQKBE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.07 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |