C15H16Cl3NO3 — CID 7722473
[2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-cyclopentylacetate (PubChem CID 7722473) has the molecular formula C15H16Cl3NO3 and a molecular weight of 364.66 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-cyclopentylacetate.
| Compound Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-cyclopentylacetate |
|---|---|
| PubChem CID | 7722473 |
| Molecular Formula | C15H16Cl3NO3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | [2-oxo-2-(2,4,6-trichloroanilino)ethyl] 2-cyclopentylacetate |
| SMILES | O=C(COC(=O)CC1CCCC1)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H16Cl3NO3/c16-10-6-11(17)15(12(18)7-10)19-13(20)8-22-14(21)5-9-3-1-2-4-9/h6-7,9H,1-5,8H2,(H,19,20) |
| InChIKey | ATZBOLVBMPMDCB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |