C22H33NO3 — CID 42968314
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 2-cyclohexylacetate (PubChem CID 42968314) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 2-cyclohexylacetate.
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 2-cyclohexylacetate |
|---|---|
| PubChem CID | 42968314 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 2-cyclohexylacetate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)CC1CCCCC1 |
| InChI | InChI=1S/C22H33NO3/c1-15(2)18-11-8-12-19(16(3)4)22(18)23-20(24)14-26-21(25)13-17-9-6-5-7-10-17/h8,11-12,15-17H,5-7,9-10,13-14H2,1-4H3,(H,23,24) |
| InChIKey | GINQROUYTZEKGR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |