About [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate (PubChem CID 27097419) has the molecular formula C25H31NO3
and a molecular weight of 393.53 g/mol. Its IUPAC name is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate |
| PubChem CID | 27097419 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C25H31NO3/c1-17(2)20-12-8-13-21(18(3)4)23(20)26-22(27)16-29-24(28)25(14-9-15-25)19-10-6-5-7-11-19/h5-8,10-13,17-18H,9,14-16H2,1-4H3,(H,26,27) |
| InChIKey | QUJUGKUKQXVUPC-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate?
The IUPAC name of [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate (CID 27097419) is [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate.
What is the SMILES notation for [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate?
The canonical SMILES for [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate is CC(C)c1cccc(C(C)C)c1NC(=O)COC(=O)C1(c2ccccc2)CCC1.
What is the InChIKey of [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate?
The InChIKey is QUJUGKUKQXVUPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31NO3/c1-17(2)20-12-8-13-21(18(3)4)23(20)26-22(27)16-29-24(28)25(14-9-15-25)19-10-6-5-7-11-19/h5-8,10-13,17-18H,9,14-16H2,1-4H3,(H,26,27).
What are the key properties of [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate?
[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate has a molecular weight of 393.53 g/mol, XLogP of 5.54, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl] 1-phenylcyclobutane-1-carboxylate is sourced from PubChem (CID 27097419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).