C22H25NO3 — CID 8588492
[2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate (PubChem CID 8588492) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate.
| Compound Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 8588492 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [2-[2-[(2S)-butan-2-yl]anilino]-2-oxoethyl] 1-phenylcyclopropane-1-carboxylate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)COC(=O)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H25NO3/c1-3-16(2)18-11-7-8-12-19(18)23-20(24)15-26-21(25)22(13-14-22)17-9-5-4-6-10-17/h4-12,16H,3,13-15H2,1-2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | IMMNFKGJIPWDIW-INIZCTEOSA-N |
| XLogP | 4.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |