C23H24F2N2O5 — CID 35974572
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 35974572) has the molecular formula C23H24F2N2O5 and a molecular weight of 446.45 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 35974572 |
| Molecular Formula | C23H24F2N2O5 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCC(=O)Nc2ccccc2OC(F)F)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H24F2N2O5/c1-16(28)27-13-11-23(12-14-27,17-7-3-2-4-8-17)21(30)31-15-20(29)26-18-9-5-6-10-19(18)32-22(24)25/h2-10,22H,11-15H2,1H3,(H,26,29) |
| InChIKey | KWIKXDKOSWRKBL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |