C25H30N2O4 — CID 8526904
[2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate (PubChem CID 8526904) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 8526904 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [2-oxo-2-[[(2R)-2-phenylpropyl]amino]ethyl] 1-acetyl-4-phenylpiperidine-4-carboxylate |
| SMILES | CC(=O)N1CCC(C(=O)OCC(=O)NC[C@H](C)c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30N2O4/c1-19(21-9-5-3-6-10-21)17-26-23(29)18-31-24(30)25(22-11-7-4-8-12-22)13-15-27(16-14-25)20(2)28/h3-12,19H,13-18H2,1-2H3,(H,26,29)/t19-/m0/s1 |
| InChIKey | RJUXIXSYHMQMJA-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |