C28H30N2O2 — CID 55368593
1-acetyl-N-(2,2-diphenylethyl)-4-phenylpiperidine-4-carboxamide (PubChem CID 55368593) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-acetyl-N-(2,2-diphenylethyl)-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-acetyl-N-(2,2-diphenylethyl)-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55368593 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 1-acetyl-N-(2,2-diphenylethyl)-4-phenylpiperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)NCC(c2ccccc2)c2ccccc2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N2O2/c1-22(31)30-19-17-28(18-20-30,25-15-9-4-10-16-25)27(32)29-21-26(23-11-5-2-6-12-23)24-13-7-3-8-14-24/h2-16,26H,17-21H2,1H3,(H,29,32) |
| InChIKey | JACZWMNJNQALAJ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |