C19H21N3O2 — CID 75460001
1-acetyl-4-phenyl-N-pyridin-2-ylpiperidine-4-carboxamide (PubChem CID 75460001) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-acetyl-4-phenyl-N-pyridin-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-acetyl-4-phenyl-N-pyridin-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75460001 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-acetyl-4-phenyl-N-pyridin-2-ylpiperidine-4-carboxamide |
| SMILES | CC(=O)N1CCC(C(=O)Nc2ccccn2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O2/c1-15(23)22-13-10-19(11-14-22,16-7-3-2-4-8-16)18(24)21-17-9-5-6-12-20-17/h2-9,12H,10-11,13-14H2,1H3,(H,20,21,24) |
| InChIKey | TXMYOMUHQRDQLW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |