C18H22N2O — CID 91229001
ethane;N-(5-methyl-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide (PubChem CID 91229001) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is ethane;N-(5-methyl-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide.
| Compound Name | ethane;N-(5-methyl-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 91229001 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | ethane;N-(5-methyl-2-pyridinyl)-1-phenylcyclopropane-1-carboxamide |
| SMILES | CC.Cc1ccc(NC(=O)C2(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C16H16N2O.C2H6/c1-12-7-8-14(17-11-12)18-15(19)16(9-10-16)13-5-3-2-4-6-13;1-2/h2-8,11H,9-10H2,1H3,(H,17,18,19);1-2H3 |
| InChIKey | QJVQBKPCNKZGOM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |